2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine
Modify Date: 2026-07-16 00:51:51
2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine structure
|
Common Name | 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 1956369-31-5 | Molecular Weight | 600.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H9Br3F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H9Br3F3N3 |
|---|---|
| Molecular Weight | 600.0 |
| InChIKey | JCKJIKFIPMZBRW-UHFFFAOYSA-N |
| SMILES | Fc1cc(Br)ccc1-c1nc(-c2ccc(Br)cc2F)nc(-c2ccc(Br)cc2F)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine? |
| A: Molecular formula of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine is C21H9Br3F3N3. |
| Q: What is the InChIKey of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine? |
| A: InChIKey of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine is JCKJIKFIPMZBRW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1956369-31-5? |
| A: Chinese name of 1956369-31-5 is 1956369-31-5. |
| Q: What is the molecular weight of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine? |
| A: Molecular weight of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine is 600.0. |
| Q: What is the SMILES notation of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine? |
| A: SMILES notation of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine is Fc1cc(Br)ccc1-c1nc(-c2ccc(Br)cc2F)nc(-c2ccc(Br)cc2F)n1. |
| Q: What is the English name of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine? |
| A: The English name of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine is 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine. |
| Q: What is the CAS number of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine? |
| A: CAS number of 2,4,6-Tris(4-bromo-2-fluorophenyl)-1,3,5-triazine is 1956369-31-5. |