2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine
Modify Date: 2026-07-01 18:18:52
![2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine Structure](https://www.chemsrc.com/extcaspic/263/1956376-14-9.png)
2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine structure
|
Common Name | 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine | ||
|---|---|---|---|---|
| CAS Number | 1956376-14-9 | Molecular Weight | 386.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9BrClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9BrClN3O2S |
|---|---|
| Molecular Weight | 386.65 |
| InChIKey | OHTSGHOGHHDIHF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(Cl)c3nc(Br)cnc32)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1956376-14-9? |
| A: Chinese name of 1956376-14-9 is 1956376-14-9. |
| Q: What is the molecular weight of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine? |
| A: Molecular weight of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine is 386.65. |
| Q: What is the InChIKey of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine? |
| A: InChIKey of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine is OHTSGHOGHHDIHF-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine? |
| A: The English name of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine is 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine. |
| Q: What is the CAS number of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine? |
| A: CAS number of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine is 1956376-14-9. |
| Q: What is the molecular formula of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine? |
| A: Molecular formula of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine is C13H9BrClN3O2S. |
| Q: What is the SMILES notation of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine? |
| A: SMILES notation of 2-Bromo-7-chloro-5-tosyl-5H-pyrrolo[2,3-b]pyrazine is Cc1ccc(S(=O)(=O)n2cc(Cl)c3nc(Br)cnc32)cc1. |