4-Benzyl-3,5-dimethylbenzonitrile
Modify Date: 2026-08-28 11:44:17
4-Benzyl-3,5-dimethylbenzonitrile structure
|
Common Name | 4-Benzyl-3,5-dimethylbenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 1956377-51-7 | Molecular Weight | 221.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Benzyl-3,5-dimethylbenzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15N |
|---|---|
| Molecular Weight | 221.30 |
| InChIKey | RYQPYXXCTKJBJH-UHFFFAOYSA-N |
| SMILES | Cc1cc(C#N)cc(C)c1Cc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Benzyl-3,5-dimethylbenzonitrile? |
| A: The English name of 4-Benzyl-3,5-dimethylbenzonitrile is 4-Benzyl-3,5-dimethylbenzonitrile. |
| Q: What is the Chinese name of 1956377-51-7? |
| A: Chinese name of 1956377-51-7 is 1956377-51-7. |
| Q: What is the molecular weight of 4-Benzyl-3,5-dimethylbenzonitrile? |
| A: Molecular weight of 4-Benzyl-3,5-dimethylbenzonitrile is 221.30. |
| Q: What is the InChIKey of 4-Benzyl-3,5-dimethylbenzonitrile? |
| A: InChIKey of 4-Benzyl-3,5-dimethylbenzonitrile is RYQPYXXCTKJBJH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-Benzyl-3,5-dimethylbenzonitrile? |
| A: Molecular formula of 4-Benzyl-3,5-dimethylbenzonitrile is C16H15N. |
| Q: What is the SMILES notation of 4-Benzyl-3,5-dimethylbenzonitrile? |
| A: SMILES notation of 4-Benzyl-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1Cc1ccccc1. |
| Q: What is the CAS number of 4-Benzyl-3,5-dimethylbenzonitrile? |
| A: CAS number of 4-Benzyl-3,5-dimethylbenzonitrile is 1956377-51-7. |