Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate
Modify Date: 2026-08-28 12:34:52
Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate structure
|
Common Name | Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1956377-55-1 | Molecular Weight | 322.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21Cl2N3O2 |
|---|---|
| Molecular Weight | 322.2 |
| InChIKey | RXUGBLBYYMALKQ-UHFFFAOYSA-N |
| SMILES | CC(C)CNCC(C)C.O=C(O)c1c(Cl)ncnc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1956377-55-1? |
| A: Chinese name of 1956377-55-1 is 1956377-55-1. |
| Q: What is the English name of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate? |
| A: The English name of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate is Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate. |
| Q: What is the SMILES notation of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate? |
| A: SMILES notation of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate is CC(C)CNCC(C)C.O=C(O)c1c(Cl)ncnc1Cl. |
| Q: What is the InChIKey of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate? |
| A: InChIKey of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate is RXUGBLBYYMALKQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate? |
| A: Molecular formula of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate is C13H21Cl2N3O2. |
| Q: What is the molecular weight of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate? |
| A: Molecular weight of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate is 322.2. |
| Q: What is the CAS number of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate? |
| A: CAS number of Diisobutylamine 4,6-dichloropyrimidine-5-carboxylate is 1956377-55-1. |