6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine
Modify Date: 2025-09-09 19:02:34
![6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine Structure](https://www.chemsrc.com/extcaspic/494/1956385-53-7.png)
6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine structure
|
Common Name | 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 1956385-53-7 | Molecular Weight | 202.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5F3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H5F3N4 |
|---|---|
| Molecular Weight | 202.14 |
| InChIKey | CDEYXHKAGLNLHM-UHFFFAOYSA-N |
| SMILES | Nc1cnc2ccc(C(F)(F)F)nn12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine? |
| A: The English name of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine is 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine. |
| Q: What is the CAS number of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine? |
| A: CAS number of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine is 1956385-53-7. |
| Q: What is the Chinese name of 1956385-53-7? |
| A: Chinese name of 1956385-53-7 is 1956385-53-7. |
| Q: What is the SMILES notation of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine? |
| A: SMILES notation of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine is Nc1cnc2ccc(C(F)(F)F)nn12. |
| Q: What is the molecular weight of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine? |
| A: Molecular weight of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine is 202.14. |
| Q: What is the InChIKey of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine? |
| A: InChIKey of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine is CDEYXHKAGLNLHM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine? |
| A: Molecular formula of 6-(Trifluoromethyl)imidazo[1,2-b]pyridazin-3-amine is C7H5F3N4. |