Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride
Modify Date: 2026-08-18 11:52:57
Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride structure
|
Common Name | Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1956386-27-8 | Molecular Weight | 308.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15BrClNO2 |
|---|---|
| Molecular Weight | 308.60 |
| InChIKey | GZZJJCSYHCKWIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(N)c1ccccc1Br.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride? |
| A: SMILES notation of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride is CCOC(=O)C(C)(N)c1ccccc1Br.Cl. |
| Q: What is the CAS number of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride? |
| A: CAS number of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride is 1956386-27-8. |
| Q: What is the English name of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride? |
| A: The English name of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride is Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride. |
| Q: What is the InChIKey of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride? |
| A: InChIKey of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride is GZZJJCSYHCKWIN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride? |
| A: Molecular weight of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride is 308.60. |
| Q: What is the Chinese name of 1956386-27-8? |
| A: Chinese name of 1956386-27-8 is 1956386-27-8. |
| Q: What is the molecular formula of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride? |
| A: Molecular formula of Ethyl 2-amino-2-(2-bromophenyl)propanoate hydrochloride is C11H15BrClNO2. |