Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate
Modify Date: 2026-07-26 10:56:59
Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate structure
|
Common Name | Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 1956386-39-2 | Molecular Weight | 261.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O3 |
|---|---|
| Molecular Weight | 261.28 |
| InChIKey | LREVOIKGNKDNJS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc(-n2c(C)nnc2CO)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate? |
| A: CAS number of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate is 1956386-39-2. |
| Q: What is the InChIKey of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate? |
| A: InChIKey of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate is LREVOIKGNKDNJS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate? |
| A: Molecular formula of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate is C13H15N3O3. |
| Q: What is the SMILES notation of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate? |
| A: SMILES notation of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate is CCOC(=O)c1cccc(-n2c(C)nnc2CO)c1. |
| Q: What is the English name of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate? |
| A: The English name of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate is Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate. |
| Q: What is the Chinese name of 1956386-39-2? |
| A: Chinese name of 1956386-39-2 is 1956386-39-2. |
| Q: What is the molecular weight of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate? |
| A: Molecular weight of Ethyl 3-(3-(hydroxymethyl)-5-methyl-4H-1,2,4-triazol-4-yl)benzoate is 261.28. |