(R)-Methyl 3-benzylpiperidine-3-carboxylate
Modify Date: 2026-08-02 17:42:20
(R)-Methyl 3-benzylpiperidine-3-carboxylate structure
|
Common Name | (R)-Methyl 3-benzylpiperidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1956435-27-0 | Molecular Weight | 233.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-Methyl 3-benzylpiperidine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO2 |
|---|---|
| Molecular Weight | 233.31 |
| InChIKey | WQZNIKREYWIGDL-CQSZACIVSA-N |
| SMILES | COC(=O)C1(Cc2ccccc2)CCCNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1956435-27-0? |
| A: Chinese name of 1956435-27-0 is 1956435-27-0. |
| Q: What is the InChIKey of (R)-Methyl 3-benzylpiperidine-3-carboxylate? |
| A: InChIKey of (R)-Methyl 3-benzylpiperidine-3-carboxylate is WQZNIKREYWIGDL-CQSZACIVSA-N. |
| Q: What is the CAS number of (R)-Methyl 3-benzylpiperidine-3-carboxylate? |
| A: CAS number of (R)-Methyl 3-benzylpiperidine-3-carboxylate is 1956435-27-0. |
| Q: What is the SMILES notation of (R)-Methyl 3-benzylpiperidine-3-carboxylate? |
| A: SMILES notation of (R)-Methyl 3-benzylpiperidine-3-carboxylate is COC(=O)C1(Cc2ccccc2)CCCNC1. |
| Q: What is the molecular formula of (R)-Methyl 3-benzylpiperidine-3-carboxylate? |
| A: Molecular formula of (R)-Methyl 3-benzylpiperidine-3-carboxylate is C14H19NO2. |
| Q: What is the molecular weight of (R)-Methyl 3-benzylpiperidine-3-carboxylate? |
| A: Molecular weight of (R)-Methyl 3-benzylpiperidine-3-carboxylate is 233.31. |
| Q: What is the English name of (R)-Methyl 3-benzylpiperidine-3-carboxylate? |
| A: The English name of (R)-Methyl 3-benzylpiperidine-3-carboxylate is (R)-Methyl 3-benzylpiperidine-3-carboxylate. |