(S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl
Modify Date: 2025-08-28 10:30:22
(S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl structure
|
Common Name | (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl | ||
|---|---|---|---|---|
| CAS Number | 1956436-83-1 | Molecular Weight | 255.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9ClF3NO2 |
|---|---|
| Molecular Weight | 255.62 |
| InChIKey | SECHOAVQAILTSH-FJXQXJEOSA-N |
| SMILES | Cl.NC(C(=O)O)c1cccc(C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl? |
| A: InChIKey of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl is SECHOAVQAILTSH-FJXQXJEOSA-N. |
| Q: What is the SMILES notation of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl? |
| A: SMILES notation of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl is Cl.NC(C(=O)O)c1cccc(C(F)(F)F)c1. |
| Q: What is the Chinese name of 1956436-83-1? |
| A: Chinese name of 1956436-83-1 is 1956436-83-1. |
| Q: What is the molecular weight of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl? |
| A: Molecular weight of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl is 255.62. |
| Q: What is the English name of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl? |
| A: The English name of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl is (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl. |
| Q: What is the CAS number of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl? |
| A: CAS number of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl is 1956436-83-1. |
| Q: What is the molecular formula of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl? |
| A: Molecular formula of (S)-2-Amino-2-(3-(trifluoromethyl)phenyl)acetic acid hcl is C9H9ClF3NO2. |