(S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate
Modify Date: 2026-08-06 13:00:06
(S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate structure
|
Common Name | (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1956437-67-4 | Molecular Weight | 388.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H18BrNO3 |
|---|---|
| Molecular Weight | 388.3 |
| InChIKey | MKKLOMJZPDZCON-KRWDZBQOSA-N |
| SMILES | O=C1CCN(C(=O)OCc2ccccc2)C1Cc1ccc(Br)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate? |
| A: Molecular weight of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate is 388.3. |
| Q: What is the English name of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate? |
| A: The English name of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate is (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate. |
| Q: What is the SMILES notation of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate? |
| A: SMILES notation of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate is O=C1CCN(C(=O)OCc2ccccc2)C1Cc1ccc(Br)cc1. |
| Q: What is the InChIKey of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate? |
| A: InChIKey of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate is MKKLOMJZPDZCON-KRWDZBQOSA-N. |
| Q: What is the molecular formula of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate? |
| A: Molecular formula of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate is C19H18BrNO3. |
| Q: What is the Chinese name of 1956437-67-4? |
| A: Chinese name of 1956437-67-4 is 1956437-67-4. |
| Q: What is the CAS number of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate? |
| A: CAS number of (S)-Benzyl 2-(4-bromobenzyl)-3-oxopyrrolidine-1-carboxylate is 1956437-67-4. |