1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine
Modify Date: 2026-09-30 12:05:40
![1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine Structure](https://www.chemsrc.com/extcaspic/272/1957192-78-7.png)
1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine structure
|
Common Name | 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 1957192-78-7 | Molecular Weight | 337.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18Cl2N4 |
|---|---|
| Molecular Weight | 337.2 |
| InChIKey | YJISKINOWNRRNX-UHFFFAOYSA-N |
| SMILES | CC1(N)CCN(c2cnc(-c3cccc(Cl)c3Cl)cn2)CC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Allosteric inhibition of 6x-histidine tagged human SHP2 (Met1-L525 residues) expresse...
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 11
External Id: CHEMBL4701889
|
|
Name: SHP2 Allosteric Inhibition Assay from US Patent US10301278: "1-(triazin-3-yl/pyridazi...
Source: BindingDB
Target: N/A
External Id: BindingDB_3128_1
|
|
Name: SHP2 Allosteric Inhibition Assay from US Patent US11401259: "1-Pyridazin-/triazin-3-y...
Source: BindingDB
Target: N/A
External Id: BindingDB_10726_1
|
|
Name: SHP2 Allosteric Inhibition Assay from US Patent US10336774: "N-azaspirocycloalkane su...
Source: BindingDB
Target: N/A
External Id: BindingDB_8610_1
|
|
Name: SHP2 Allosteric Inhibition Assay from US Patent US10093646: "1-pyridazin-/triazin-3-y...
Source: BindingDB
Target: N/A
External Id: BindingDB_745_1
|
Total 5, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine? |
| A: The English name of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine is 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine. |
| Q: What is the CAS number of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine? |
| A: CAS number of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine is 1957192-78-7. |
| Q: What is the molecular weight of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine? |
| A: Molecular weight of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine is 337.2. |
| Q: What is the InChIKey of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine? |
| A: InChIKey of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine is YJISKINOWNRRNX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1957192-78-7? |
| A: Chinese name of 1957192-78-7 is 1957192-78-7. |
| Q: What is the SMILES notation of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine? |
| A: SMILES notation of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine is CC1(N)CCN(c2cnc(-c3cccc(Cl)c3Cl)cn2)CC1. |
| Q: What is the molecular formula of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine? |
| A: Molecular formula of 1-[5-(2,3-Dichlorophenyl)pyrazin-2-yl]-4-methylpiperidin-4-amine is C16H18Cl2N4. |