Thalidomide-NH-(CH2)2-NH-Boc structure
|
Common Name | Thalidomide-NH-(CH2)2-NH-Boc | ||
|---|---|---|---|---|
| CAS Number | 1957235-57-2 | Molecular Weight | 416.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-NH-(CH2)2-NH-BocThalidomide-NH-(CH2)2-NH-Boc is a Boc-modified Thalidomide (HY-14658) that acts as a Cereblon ligand to recruit CRBN protein. The Boc protecting group at the end of Thalidomide-NH-(CH2)2-NH-Boc can be removed under acidic conditions to participate in the synthesis of PROTAC molecules. Thalidomide-NH-(CH2)2-NH-Boc is a key intermediate in the synthesis of CRBN-based PROTAC molecules. |
| Name | N-[2-[[2-(2,6-Dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]amino]ethyl]-carbamic Acid 1,1-Dimethylethyl Ester |
|---|
| Description | Thalidomide-NH-(CH2)2-NH-Boc is a Boc-modified Thalidomide (HY-14658) that acts as a Cereblon ligand to recruit CRBN protein. The Boc protecting group at the end of Thalidomide-NH-(CH2)2-NH-Boc can be removed under acidic conditions to participate in the synthesis of PROTAC molecules. Thalidomide-NH-(CH2)2-NH-Boc is a key intermediate in the synthesis of CRBN-based PROTAC molecules. |
|---|---|
| Related Catalog |
| Molecular Formula | C20H24N4O6 |
|---|---|
| Molecular Weight | 416.43 |
| Appearance of Characters | Solid | Yellow |
| InChIKey | CTBFCHXDKXTELK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Water Solubility | Dichloromethane, Ethyl Acetate, Methanol |