Thalidomide-NH-(CH2)2-NH2 TFA structure
|
Common Name | Thalidomide-NH-(CH2)2-NH2 TFA | ||
|---|---|---|---|---|
| CAS Number | 1957235-67-4 | Molecular Weight | 430.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17F3N4O6 | Melting Point | >224°C (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-NH-(CH2)2-NH2 TFAThalidomide-NH-(CH2)2-NH2 TFA is an alkyl-modified Thalidomide (HY-14658) that acts as a Cereblon ligand to recruit CRBN proteins. Thalidomide-NH-(CH2)2-NH2 TFA is a key intermediate in the synthesis of CRBN-based PROTAC molecules designed to synthesize small PROTAC molecules targeting SHP2 protein. |
| Name | N-[2-Aminoethyl] Pomalidomide Trifluoroacetic Acid Salt |
|---|
| Description | Thalidomide-NH-(CH2)2-NH2 TFA is an alkyl-modified Thalidomide (HY-14658) that acts as a Cereblon ligand to recruit CRBN proteins. Thalidomide-NH-(CH2)2-NH2 TFA is a key intermediate in the synthesis of CRBN-based PROTAC molecules designed to synthesize small PROTAC molecules targeting SHP2 protein. |
|---|---|
| Related Catalog |
| Melting Point | >224°C (dec.) |
|---|---|
| Molecular Formula | C17H17F3N4O6 |
| Molecular Weight | 430.34 |
| Appearance of Characters | Solid | Light Orange to Yellow |
| InChIKey | OXSMNKJVQUZNEJ-UHFFFAOYSA-N |
| SMILES | NCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.O=C(O)C(F)(F)F |
| Storage condition | Hygroscopic, Refrigerator, under inert atmosphere |
| Water Solubility | DMSO (Slightly), Methanol (Slightly) |