1-[(4-methoxy-3-nitro-phenyl)methylsulfanyl]-N,N-dimethyl-methanethioamide structure
|
Common Name | 1-[(4-methoxy-3-nitro-phenyl)methylsulfanyl]-N,N-dimethyl-methanethioamide | ||
|---|---|---|---|---|
| CAS Number | 19579-24-9 | Molecular Weight | 286.37000 | |
| Density | 1.317g/cm3 | Boiling Point | 431.5ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.8ºC | |
| Name | (4-methoxy-3-nitrophenyl)methyl N,N-dimethylcarbamodithioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 431.5ºC at 760 mmHg |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.37000 |
| Flash Point | 214.8ºC |
| Exact Mass | 286.04500 |
| PSA | 115.68000 |
| LogP | 3.20630 |
| Vapour Pressure | 1.19E-07mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | UXPDWSGGGMACOF-UHFFFAOYSA-N |
| SMILES | COc1ccc(CSC(=S)N(C)C)cc1[N+](=O)[O-] |
|
~%
1-[(4-methoxy-3... CAS#:19579-24-9 |
| Literature: Kulka Canadian Journal of Chemistry, 1956 , vol. 34, p. 1093,1099 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Dimethyl-dithiocarbamidsaeure-(4-methoxy-3-nitro-benzylester) |
| dimethyl-dithiocarbamic acid-(4-methoxy-3-nitro-benzyl ester) |
| 4-methoxy-3-nitrobenzyl dimethylcarbamodithioate |