5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester
Modify Date: 2026-08-02 09:07:43
5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester structure
|
Common Name | 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1958063-14-3 | Molecular Weight | 238.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18N2O3 |
|---|---|
| Molecular Weight | 238.28 |
| InChIKey | SSOWMYDVBHAITG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C)nn1C1CCOCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester? |
| A: The English name of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester is 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester. |
| Q: What is the Chinese name of 1958063-14-3? |
| A: Chinese name of 1958063-14-3 is 1958063-14-3. |
| Q: What is the CAS number of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester? |
| A: CAS number of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester is 1958063-14-3. |
| Q: What is the SMILES notation of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester? |
| A: SMILES notation of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester is CCOC(=O)c1cc(C)nn1C1CCOCC1. |
| Q: What is the InChIKey of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester? |
| A: InChIKey of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester is SSOWMYDVBHAITG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester? |
| A: Molecular formula of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester is C12H18N2O3. |
| Q: What is the molecular weight of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester? |
| A: Molecular weight of 5-Methyl-2-(tetrahydro-pyran-4-YL)-2H-pyrazole-3-carboxylic acid ethyl ester is 238.28. |