3-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5,6,7-trimethoxy-chromen-4-one structure
|
Common Name | 3-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5,6,7-trimethoxy-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 19587-69-0 | Molecular Weight | 374.34100 | |
| Density | 1.393g/cm3 | Boiling Point | 595.7ºC at 760 mmHg | |
| Molecular Formula | C19H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.8ºC | |
| Name | 3-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 595.7ºC at 760 mmHg |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.34100 |
| Flash Point | 214.8ºC |
| Exact Mass | 374.10000 |
| PSA | 107.59000 |
| LogP | 2.90560 |
| Vapour Pressure | 4.87E-15mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | UEPKLBOJSLVOIP-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(OC)c(OC)c(OC)c3c(=O)c2O)cc1O |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EUPATORETIN |
| 3-hydroxy-2-(3-hydroxy-4-methoxy-phenyl)-5,6,7-trimethoxy-chromen-4-one |
| 3-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-5,6,7-trimethoxy-4h-chromen-4-one |
| Flavonoid L |