Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate
Modify Date: 2025-09-10 09:04:33
![Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate Structure](https://www.chemsrc.com/extcaspic/161/1959577-49-1.png)
Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate structure
|
Common Name | Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 1959577-49-1 | Molecular Weight | 321.80 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20ClN3O2 |
|---|---|
| Molecular Weight | 321.80 |
| InChIKey | UCYWOAKKCNEDCI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(C)C1CCC(c2ncc3c(Cl)nccn23)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate? |
| A: Molecular formula of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate is C16H20ClN3O2. |
| Q: What is the Chinese name of 1959577-49-1? |
| A: Chinese name of 1959577-49-1 is 1959577-49-1. |
| Q: What is the InChIKey of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate? |
| A: InChIKey of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate is UCYWOAKKCNEDCI-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate? |
| A: The English name of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate is Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate. |
| Q: What is the molecular weight of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate? |
| A: Molecular weight of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate is 321.80. |
| Q: What is the CAS number of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate? |
| A: CAS number of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate is 1959577-49-1. |
| Q: What is the SMILES notation of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate? |
| A: SMILES notation of Methyl 2-(3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclopentyl)-2-methylpropanoate is COC(=O)C(C)(C)C1CCC(c2ncc3c(Cl)nccn23)C1. |