Ethanone, 1,1-(4-ethoxy-2,6-pyridinediyl)bis- (9CI) structure
|
Common Name | Ethanone, 1,1-(4-ethoxy-2,6-pyridinediyl)bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 195967-09-0 | Molecular Weight | 207.22600 | |
| Density | 1.112g/cm3 | Boiling Point | 331.8ºC at 760mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.4ºC | |
| Name | Ethanone, 1,1-(4-ethoxy-2,6-pyridinediyl)bis- (9CI) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.112g/cm3 |
|---|---|
| Boiling Point | 331.8ºC at 760mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 154.4ºC |
| Exact Mass | 207.09000 |
| PSA | 56.26000 |
| LogP | 1.88550 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | QKNLMVOIEUSWEW-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C(C)=O)nc(C(C)=O)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1'-(4-Ethoxypyridine-2,6-diyl)diethanone |