10-Methyl-10H-phenothiazine 5,5-dioxide structure
|
Common Name | 10-Methyl-10H-phenothiazine 5,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 19607-01-3 | Molecular Weight | 245.29700 | |
| Density | 1.335g/cm3 | Boiling Point | 435.9ºC at 760 mmHg | |
| Molecular Formula | C13H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.4ºC | |
| Name | 10-methylphenothiazine 5,5-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 435.9ºC at 760 mmHg |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.29700 |
| Flash Point | 217.4ºC |
| Exact Mass | 245.05100 |
| PSA | 45.76000 |
| LogP | 3.74650 |
| Vapour Pressure | 8.47E-08mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | SSIOPLVRUPBGPG-UHFFFAOYSA-N |
| SMILES | CN1c2ccccc2S(=O)(=O)c2ccccc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-Methyl-phenothiazin-5,5-dioxid |
| 10H-Phenothiazine,10-methyl-,5,5-dioxide |
| N(10)-methylphenothiazine-S,S-dioxide |
| 10-methyl-phenothiazine-5,5-dioxide |
| 10-Methyl-phenothiazine 5,5-dioxyde |
| 10-Methyl-10H-phenothiazine 5,5-dioxide |