Benzenebutanoic acid, a-(3,4-dimethoxyphenyl)-3,4-dimethoxy structure
|
Common Name | Benzenebutanoic acid, a-(3,4-dimethoxyphenyl)-3,4-dimethoxy | ||
|---|---|---|---|---|
| CAS Number | 19611-19-9 | Molecular Weight | 360.40100 | |
| Density | 1.172g/cm3 | Boiling Point | 491.2ºC at 760mmHg | |
| Molecular Formula | C20H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.4ºC | |
| Name | 2,4-bis(3,4-dimethoxyphenyl)butanoic acid |
|---|
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 491.2ºC at 760mmHg |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.40100 |
| Flash Point | 168.4ºC |
| Exact Mass | 360.15700 |
| PSA | 74.22000 |
| LogP | 3.52200 |
| Vapour Pressure | 1.82E-10mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | IWNWGLGFQGZFKD-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCC(C(=O)O)c2ccc(OC)c(OC)c2)cc1OC |
|
~%
Benzenebutanoic... CAS#:19611-19-9 |
| Literature: Weinges,K.; Nagel,D. Chemische Berichte, 1968 , vol. 101, p. 3018 - 3021 |
|
~%
Benzenebutanoic... CAS#:19611-19-9 |
| Literature: Richardson et al. Journal of the Chemical Society, 1937 , p. 835,839 |
|
~%
Benzenebutanoic... CAS#:19611-19-9 |
| Literature: Richardson et al. Journal of the Chemical Society, 1937 , p. 835,839 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |