2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid
Modify Date: 2025-08-29 05:19:14
![2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/049/1961908-50-8.png)
2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid structure
|
Common Name | 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1961908-50-8 | Molecular Weight | 280.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11F3O2 |
|---|---|
| Molecular Weight | 280.24 |
| InChIKey | XQPCZRPHRQKQPZ-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1ccc(C(=O)O)c(C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: InChIKey of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is XQPCZRPHRQKQPZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: Molecular weight of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is 280.24. |
| Q: What is the SMILES notation of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: SMILES notation of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is Cc1ccccc1-c1ccc(C(=O)O)c(C(F)(F)F)c1. |
| Q: What is the molecular formula of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: Molecular formula of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is C15H11F3O2. |
| Q: What is the Chinese name of 1961908-50-8? |
| A: Chinese name of 1961908-50-8 is 1961908-50-8. |
| Q: What is the English name of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: The English name of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid. |
| Q: What is the CAS number of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid? |
| A: CAS number of 2'-Methyl-3-(trifluoromethyl)-[1,1'-biphenyl]-4-carboxylic acid is 1961908-50-8. |