methyl (8S)-8-methyl-6-oxo-7,8-dihydro-5H-2,7-naphthyridine-4-carboxyl ate structure
|
Common Name | methyl (8S)-8-methyl-6-oxo-7,8-dihydro-5H-2,7-naphthyridine-4-carboxyl ate | ||
|---|---|---|---|---|
| CAS Number | 19634-30-1 | Molecular Weight | 220.22500 | |
| Density | 1.224g/cm3 | Boiling Point | 440.4ºC at 760mmHg | |
| Molecular Formula | C11H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | methyl (8S)-8-methyl-6-oxo-7,8-dihydro-5H-2,7-naphthyridine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 440.4ºC at 760mmHg |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.22500 |
| Flash Point | 220.1ºC |
| Exact Mass | 220.08500 |
| PSA | 71.78000 |
| LogP | 0.87740 |
| Vapour Pressure | 5.92E-08mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | KSMITTDZTTZFML-LURJTMIESA-N |
| SMILES | COC(=O)c1cncc2c1CC(=O)NC2C |
| HS Code | 2933990090 |
|---|
|
~%
methyl (8S)-8-m... CAS#:19634-30-1 |
| Literature: Bennasar, M.-Lluisa; Roca, Tomas; Zulaica, Ester; Monerris, Manuel Tetrahedron, 2004 , vol. 60, # 32 p. 6785 - 6789 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Alkaloid LA 12,from Ligustrum vulgare |
| 8-methyl-6-oxo-5,6,7,8-tetrahydro-[2,7]naphthyridine-4-carboxylic acid methyl ester |
| Jasminine |
| 2,7-Naphthyridine-4-carboxylicacid,5,6,7,8-tetrahydro-8-methyl-6-oxo-,methyl ester,(8S) |
| 2,7-Naphthyridine-4-carboxylicacid,5,6,7,8-tetrahydro-8-methyl-6-oxo-,methyl ester,(S) |
| Jasminine (8CI) |
| LA 12 |