3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate
Modify Date: 2025-09-09 14:56:13
3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate structure
|
Common Name | 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1964518-02-2 | Molecular Weight | 244.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12N2O4S |
|---|---|
| Molecular Weight | 244.27 |
| InChIKey | PFNXVTMRJKNDGX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C(=O)OC)csc1NN |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate? |
| A: SMILES notation of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate is CCOC(=O)c1c(C(=O)OC)csc1NN. |
| Q: What is the molecular formula of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate? |
| A: Molecular formula of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate is C9H12N2O4S. |
| Q: What is the Chinese name of 1964518-02-2? |
| A: Chinese name of 1964518-02-2 is 1964518-02-2. |
| Q: What is the InChIKey of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate? |
| A: InChIKey of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate is PFNXVTMRJKNDGX-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate? |
| A: The English name of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate is 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate. |
| Q: What is the CAS number of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate? |
| A: CAS number of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate is 1964518-02-2. |
| Q: What is the molecular weight of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate? |
| A: Molecular weight of 3-Ethyl 4-methyl 2-hydrazinylthiophene-3,4-dicarboxylate is 244.27. |