2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride structure
|
Common Name | 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1965308-84-2 | Molecular Weight | 262.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13Cl2NO2 |
|---|---|
| Molecular Weight | 262.13 |
| InChIKey | KCLBNFZFQGVZTG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(N)Cc2ccc(Cl)cc2C1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1965308-84-2? |
| A: Chinese name of 1965308-84-2 is 1965308-84-2. |
| Q: What is the English name of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride? |
| A: The English name of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride is 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride. |
| Q: What is the SMILES notation of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride? |
| A: SMILES notation of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride is COC(=O)C1(N)Cc2ccc(Cl)cc2C1.Cl. |
| Q: What is the molecular formula of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride? |
| A: Molecular formula of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride is C11H13Cl2NO2. |
| Q: What is the CAS number of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride? |
| A: CAS number of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride is 1965308-84-2. |
| Q: What is the molecular weight of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride? |
| A: Molecular weight of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride is 262.13. |
| Q: What is the InChIKey of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride? |
| A: InChIKey of 2-Amino-5-chloro-indan-2-carboxylic acid methyl ester hydrochloride is KCLBNFZFQGVZTG-UHFFFAOYSA-N. |