ethyl 2-(ethoxycarbonylsulfanylcarbothioylamino)ethylcarbamothioylsulfanylformate structure
|
Common Name | ethyl 2-(ethoxycarbonylsulfanylcarbothioylamino)ethylcarbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 19657-27-3 | Molecular Weight | 356.50500 | |
| Density | 1.391g/cm3 | Boiling Point | 463.8ºC at 760mmHg | |
| Molecular Formula | C10H16N2O4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.3ºC | |
| Name | ethyl 2-(ethoxycarbonylsulfanylcarbothioylamino)ethylcarbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.391g/cm3 |
|---|---|
| Boiling Point | 463.8ºC at 760mmHg |
| Molecular Formula | C10H16N2O4S4 |
| Molecular Weight | 356.50500 |
| Flash Point | 234.3ºC |
| Exact Mass | 355.99900 |
| PSA | 205.52000 |
| LogP | 3.33740 |
| Vapour Pressure | 8.8E-09mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | GAEADZPCZCQRKA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)NCCNC(=S)SC(=O)OCC |
|
~%
ethyl 2-(ethoxy... CAS#:19657-27-3 |
| Literature: Jakubowitsch; Klimowa Zhurnal Obshchei Khimii, 1939 , vol. 9, p. 1782 Chem. Zentralbl., 1940 , vol. 111, # I p. 1973 |
| 3,8-dithioxo-2,9-dithia-4,7-diaza-decanedioic acid diethyl ester |
| Carbonic acid,thio-,bis(anhydrosulfide) with ethylenebis(dithiocarbamic acid),diethyl ester |
| 3,8-Dithioxo-2,9-dithia-4,7-diaza-decandisaeure-diaethylester |
| Thiocarbonic acid bis(anhydrosulfide) with ethylenebis(dithiocarbamic acid) diethyl ester |