ethyl 6-(ethoxycarbonylsulfanylcarbothioylamino)hexylcarbamothioylsulfanylformate
Modify Date: 2025-10-19 18:22:39
ethyl 6-(ethoxycarbonylsulfanylcarbothioylamino)hexylcarbamothioylsulfanylformate structure
|
Common Name | ethyl 6-(ethoxycarbonylsulfanylcarbothioylamino)hexylcarbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 19657-28-4 | Molecular Weight | 412.61100 | |
| Density | 1.28g/cm3 | Boiling Point | 515.1ºC at 760mmHg | |
| Molecular Formula | C14H24N2O4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.3ºC | |
| Name | ethyl 6-(ethoxycarbonylsulfanylcarbothioylamino)hexylcarbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 515.1ºC at 760mmHg |
| Molecular Formula | C14H24N2O4S4 |
| Molecular Weight | 412.61100 |
| Flash Point | 265.3ºC |
| Exact Mass | 412.06200 |
| PSA | 205.52000 |
| LogP | 4.89780 |
| Vapour Pressure | 1.02E-10mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | QSUBUALRKKUPPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)NCCCCCCNC(=S)SC(=O)OCC |
| Carbonic acid,thio-,bis(anhydrosulfide) with hexamethylenebis(dithiocarbamic acid),diethyl ester |