Ethyl 3-(2,3-Dihydrobenzofuran-5-yl)propanoate
Modify Date: 2025-09-11 11:11:13
Ethyl 3-(2,3-Dihydrobenzofuran-5-yl)propanoate structure
|
Common Name | Ethyl 3-(2,3-Dihydrobenzofuran-5-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 196597-66-7 | Molecular Weight | 220.26400 | |
| Density | 1.127g/cm3 | Boiling Point | 320.843ºC at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.738ºC | |
| Name | Ethyl 3-(2,3-Dihydrobenzofuran-5-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 320.843ºC at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 131.738ºC |
| Exact Mass | 220.11000 |
| PSA | 35.53000 |
| LogP | 2.11720 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | FBGXCVKXTGMFFA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1ccc2c(c1)CCO2 |
| Storage condition | -20°C |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 3-(2,3-dihydro-1-benzofuran-5-yl)propanoate |