9H-Fluoren-2-amine,N,9-bis[[4-(dimethylamino)phenyl]methylene]- structure
|
Common Name | 9H-Fluoren-2-amine,N,9-bis[[4-(dimethylamino)phenyl]methylene]- | ||
|---|---|---|---|---|
| CAS Number | 19661-40-6 | Molecular Weight | 443.58200 | |
| Density | 1.07g/cm3 | Boiling Point | 638.7ºC at 760mmHg | |
| Molecular Formula | C31H29N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.1ºC | |
| Name | 4-[[2-[[4-(dimethylamino)phenyl]methylideneamino]fluoren-9-ylidene]methyl]-N,N-dimethylaniline |
|---|
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 638.7ºC at 760mmHg |
| Molecular Formula | C31H29N3 |
| Molecular Weight | 443.58200 |
| Flash Point | 340.1ºC |
| Exact Mass | 443.23600 |
| PSA | 18.84000 |
| LogP | 7.13850 |
| Vapour Pressure | 3.27E-16mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | MRDRCYQHHJZNJG-KVECMABRSA-N |
| SMILES | CN(C)c1ccc(C=Nc2ccc3c(c2)C(=Cc2ccc(N(C)C)cc2)c2ccccc2-3)cc1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |