2-(4-Chlorophenyl)-Propanedioicacid 1,3-Diethyl Ester structure
|
Common Name | 2-(4-Chlorophenyl)-Propanedioicacid 1,3-Diethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 19677-37-3 | Molecular Weight | 270.709 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 334.1±27.0 °C at 760 mmHg | |
| Molecular Formula | C13H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.2±22.7 °C | |
| Name | diethyl 2-(4-chlorophenyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 334.1±27.0 °C at 760 mmHg |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.709 |
| Flash Point | 125.2±22.7 °C |
| Exact Mass | 270.065887 |
| PSA | 52.60000 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | PPESOPZGUSEQSO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccc(Cl)cc1 |
| HS Code | 2917399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Diethyl (4-chlorophenyl)malonate |
| p-chlorophenyl diethyl malonate |
| Propanedioic acid, 2-(4-chlorophenyl)-, diethyl ester |