25R-Inokosterone structure
|
Common Name | 25R-Inokosterone | ||
|---|---|---|---|---|
| CAS Number | 19682-38-3 | Molecular Weight | 480.634 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 713.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C27H44O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 399.1±29.4 °C | |
Use of 25R-Inokosterone25R-Inokosterone is a phytoecdysone isolated from Achyranthis Radix[1]. |
| Name | inokosterone |
|---|---|
| Synonym | More Synonyms |
| Description | 25R-Inokosterone is a phytoecdysone isolated from Achyranthis Radix[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 713.2±60.0 °C at 760 mmHg |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.634 |
| Flash Point | 399.1±29.4 °C |
| Exact Mass | 480.308716 |
| PSA | 138.45000 |
| LogP | -0.46 |
| Vapour Pressure | 0.0±5.2 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | JQNVCUBPURTQPQ-NXLPOQTDSA-N |
| SMILES | CC(CO)CCC(O)C(C)(O)C1CCC2(O)C3=CC(=O)C4CC(O)C(O)CC4(C)C3CCC12C |
| Cholest-7-en-6-one, 2,3,14,20,22,26-hexahydroxy-, (2β,3β,5β,22R,25R)- |
| Inokosteron |
| (2β,3β,5β,22R,25R)-2,3,14,20,22,26-Hexahydroxycholest-7-en-6-one |
| (25R)-Inokosterone |