(5-amino-3-methyl-1-phenylpyrazol-4-yl) thiocyanate
Modify Date: 2026-06-30 10:18:32
(5-amino-3-methyl-1-phenylpyrazol-4-yl) thiocyanate structure
|
Common Name | (5-amino-3-methyl-1-phenylpyrazol-4-yl) thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 19688-95-0 | Molecular Weight | 230.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-amino-3-methyl-1-phenylpyrazol-4-yl) thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N4S |
|---|---|
| Molecular Weight | 230.28900 |
| Exact Mass | 230.06300 |
| PSA | 92.93000 |
| LogP | 2.91728 |
| InChIKey | LRJWBZOWAHNTSL-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccccc2)c(N)c1SC#N |
|
~89%
(5-amino-3-meth... CAS#:19688-95-0 |
| Literature: Thiruvikraman, S. V.; Seshadri, S. Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 2 p. 785 - 786 |
| 5-methyl-2-phenyl-4-thiocyanato-2H-pyrazol-3-ylamine |
| Thiocyanic acid,5-amino-3-methyl-1-phenyl-1H-pyrazol-4-yl ester |
| 5-amino-3-methyl-1-phenyl-4-thiocyanatopyrazole |
| 1-Phenyl-3-methyl-4-rhodan-5-amino-pyrazol |