3-amino-5-[(2-hydroxyacetyl)amino]benzoic acid structure
|
Common Name | 3-amino-5-[(2-hydroxyacetyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 19714-81-9 | Molecular Weight | 210.18700 | |
| Density | 1.558g/cm3 | Boiling Point | 596.8ºC at 760mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.7ºC | |
| Name | 3-amino-5-[(2-hydroxyacetyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.558g/cm3 |
|---|---|
| Boiling Point | 596.8ºC at 760mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 314.7ºC |
| Exact Mass | 210.06400 |
| PSA | 112.65000 |
| LogP | 0.55200 |
| Vapour Pressure | 4.34E-15mmHg at 25°C |
| Index of Refraction | 1.719 |
| InChIKey | OKZGMVXCYARPKZ-UHFFFAOYSA-N |
| SMILES | Nc1cc(NC(=O)CO)cc(C(=O)O)c1 |
|
~%
3-amino-5-[(2-h... CAS#:19714-81-9 |
| Literature: Larsen et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 3210,3215 |
|
~%
3-amino-5-[(2-h... CAS#:19714-81-9 |
| Literature: Larsen et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 3210,3215 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Amino-5-glykoloylamino-benzoesaeure |
| 3-amino-5-glycoloylamino-benzoic acid |
| 3-amino-5-[(hydroxyacetyl)amino]benzoic acid |