bis(4-bromophenyl)mercury structure
|
Common Name | bis(4-bromophenyl)mercury | ||
|---|---|---|---|---|
| CAS Number | 19719-72-3 | Molecular Weight | 512.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Br2Hg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-bromophenyl)mercury |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8Br2Hg |
|---|---|
| Molecular Weight | 512.59000 |
| Exact Mass | 511.87000 |
| LogP | 4.38630 |
| InChIKey | RUEDRTRRBSCZEZ-UHFFFAOYSA-N |
| SMILES | Brc1ccc([Hg]c2ccc(Br)cc2)cc1 |
|
~%
bis(4-bromophen... CAS#:19719-72-3 |
| Literature: Challenger; Richards Journal of the Chemical Society, 1934 , p. 405,408 |
| Mercury,bis(4-bromophenyl) |
| Bis-<p-brom-phenyl>-quecksilber |
| Di-p-bromphenyl-quecksilber |
| bis-(4-bromo-phenyl)-mercury |
| Bis-(4-brom-phenyl)-quecksilber |