z-asp-ome dcha structure
|
Common Name | z-asp-ome dcha | ||
|---|---|---|---|---|
| CAS Number | 19720-12-8 | Molecular Weight | 462.57900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H38N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-cyclohexylcyclohexanamine,(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H38N2O6 |
|---|---|
| Molecular Weight | 462.57900 |
| Exact Mass | 462.27300 |
| PSA | 113.96000 |
| LogP | 4.95230 |
| InChIKey | JODDUFBZPMVOHC-PPHPATTJSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.COC(=O)C(CC(=O)O)NC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
z-asp-ome dcha CAS#:19720-12-8 |
| Literature: Manturewicz; Grzonka Polish Journal of Chemistry, 2007 , vol. 81, # 12 p. 2121 - 2131 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Benzyloxycarbonyl-L-aspartic acid 1-methyl ester dicyclohexylamine salt |
| Z-Asp-OMe DCHA |