2,4-Dioxo-1,3-diazaspiro[4.5]decane-6-carboxylic acid ethyl ester structure
|
Common Name | 2,4-Dioxo-1,3-diazaspiro[4.5]decane-6-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1975-87-7 | Molecular Weight | 240.25600 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2,4-dioxo-1,3-diazaspiro[4.5]decane-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.25600 |
| Exact Mass | 240.11100 |
| PSA | 91.48000 |
| LogP | 0.23380 |
| Index of Refraction | 1.536 |
| InChIKey | HSLTZBCHVYFTBO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCCCC12NC(=O)NC2=O |
|
~%
2,4-Dioxo-1,3-d... CAS#:1975-87-7 |
| Literature: Sheppeck II, James E.; Gilmore, John L.; Yang, Anle; Chen, Xiao-Tao; Xue, Chu-Biao; Roderick, John; Liu, Rui-Qin; Covington, Maryanne B.; Decicco, Carl P.; Duan, James J.-W. Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 5 p. 1413 - 1417 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Ethoxycarbonyl-cyclohexanspiro-5'-hydantoin |