Potassium (1-cyclopropylvinyl)trifluoroborate
Modify Date: 2025-09-03 21:40:49
Potassium (1-cyclopropylvinyl)trifluoroborate structure
|
Common Name | Potassium (1-cyclopropylvinyl)trifluoroborate | ||
|---|---|---|---|---|
| CAS Number | 1978375-79-9 | Molecular Weight | 174.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H7BF3K | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Potassium (1-cyclopropylvinyl)trifluoroborate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H7BF3K |
|---|---|
| Molecular Weight | 174.02 |
| InChIKey | DIVPEPWVRKQOCS-UHFFFAOYSA-N |
| SMILES | C=C(C1CC1)[B-](F)(F)F.[K+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Potassium (1-cyclopropylvinyl)trifluoroborate? |
| A: Molecular formula of Potassium (1-cyclopropylvinyl)trifluoroborate is C5H7BF3K. |
| Q: What is the SMILES notation of Potassium (1-cyclopropylvinyl)trifluoroborate? |
| A: SMILES notation of Potassium (1-cyclopropylvinyl)trifluoroborate is C=C(C1CC1)[B-](F)(F)F.[K+]. |
| Q: What is the English name of Potassium (1-cyclopropylvinyl)trifluoroborate? |
| A: The English name of Potassium (1-cyclopropylvinyl)trifluoroborate is Potassium (1-cyclopropylvinyl)trifluoroborate. |
| Q: What is the Chinese name of 1978375-79-9? |
| A: Chinese name of 1978375-79-9 is 1978375-79-9. |
| Q: What is the InChIKey of Potassium (1-cyclopropylvinyl)trifluoroborate? |
| A: InChIKey of Potassium (1-cyclopropylvinyl)trifluoroborate is DIVPEPWVRKQOCS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Potassium (1-cyclopropylvinyl)trifluoroborate? |
| A: Molecular weight of Potassium (1-cyclopropylvinyl)trifluoroborate is 174.02. |
| Q: What is the CAS number of Potassium (1-cyclopropylvinyl)trifluoroborate? |
| A: CAS number of Potassium (1-cyclopropylvinyl)trifluoroborate is 1978375-79-9. |