2-[(9,10-dihydro-9,10-dioxo-1-anthryl)amino]benzoic acid structure
|
Common Name | 2-[(9,10-dihydro-9,10-dioxo-1-anthryl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 19795-96-1 | Molecular Weight | 343.33200 | |
| Density | 1.444g/cm3 | Boiling Point | 573.4ºC at 760mmHg | |
| Molecular Formula | C21H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.6ºC | |
| Name | 2-[(9,10-dioxoanthracen-1-yl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 573.4ºC at 760mmHg |
| Molecular Formula | C21H13NO4 |
| Molecular Weight | 343.33200 |
| Flash Point | 300.6ºC |
| Exact Mass | 343.08400 |
| PSA | 83.47000 |
| LogP | 3.97680 |
| Vapour Pressure | 5.45E-14mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | BXSCARJCEFJTJZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1cccc2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-anilido-o-carboxyanthraquinone |
| 1-anilido-o-carboxy-9,10-anthracene-dione |