Maltoheptaose
Maltoheptaose structure
|
Common Name | Maltoheptaose | ||
|---|---|---|---|---|
| CAS Number | 1980-14-9 | Molecular Weight | 1153.000 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 1492.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C42H72O36 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 424.2±27.8 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Maltoheptaose |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 1492.7±65.0 °C at 760 mmHg |
| Molecular Formula | C42H72O36 |
| Molecular Weight | 1153.000 |
| Flash Point | 424.2±27.8 °C |
| Exact Mass | 1152.380371 |
| LogP | -8.62 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.700 |
| InChIKey | WWDPIUOBYLGGIJ-KIXFCQHQSA-N |
| SMILES | OCC1OC(OCC2OC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(OC3OC(CO)C(O)C(O)C3O)C(OC3OC(CO)C(O)C(O)C3O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Maltoheptaose |
| EINECS 252-119-4 |
| α-D-Glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-D-glucose |
| MFCD00064605 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Maltoheptaose? |
| A: InChIKey of Maltoheptaose is WWDPIUOBYLGGIJ-KIXFCQHQSA-N. |
| Q: What is the Chinese name of 1980-14-9? |
| A: Chinese name of 1980-14-9 is 1980-14-9. |
| Q: What is the molecular weight of Maltoheptaose? |
| A: Molecular weight of Maltoheptaose is 1153.000. |
| Q: What is the English name of Maltoheptaose? |
| A: The English name of Maltoheptaose is Maltoheptaose. |
| Q: What is the boiling point of Maltoheptaose? |
| A: Boiling point of Maltoheptaose is 1492.7±65.0 °C at 760 mmHg. |
| Q: What is the molecular formula of Maltoheptaose? |
| A: Molecular formula of Maltoheptaose is C42H72O36. |
| Q: What is the CAS number of Maltoheptaose? |
| A: CAS number of Maltoheptaose is 1980-14-9. |
| Q: What is the LogP of Maltoheptaose? |
| A: LogP of Maltoheptaose is -8.62. |
| Q: What English synonyms does Maltoheptaose have? |
| A: English synonyms of Maltoheptaose: Maltoheptaose, EINECS 252-119-4, α-D-Glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-α-D-glucopyranosyl-(1->4)-D-glucose, MFCD00064605. |
| Q: What is the SMILES notation of Maltoheptaose? |
| A: SMILES notation of Maltoheptaose is OCC1OC(OCC2OC(OC3OC(CO)C(O)C(O)C3OC3OC(CO)C(O)C(O)C3O)C(OC3OC(CO)C(O)C(O)C3O)C(OC3OC(CO)C(O)C(O)C3O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |