Acetic acid,2-(2,4-dichlorophenoxy)-, 2-chloroethyl ester structure
|
Common Name | Acetic acid,2-(2,4-dichlorophenoxy)-, 2-chloroethyl ester | ||
|---|---|---|---|---|
| CAS Number | 19810-30-1 | Molecular Weight | 283.53600 | |
| Density | 1.405g/cm3 | Boiling Point | 379.4ºC at 760mmHg | |
| Molecular Formula | C10H9Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | Acetic acid,2-(2,4-dichlorophenoxy)-,2-chloroethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405g/cm3 |
|---|---|
| Boiling Point | 379.4ºC at 760mmHg |
| Molecular Formula | C10H9Cl3O3 |
| Molecular Weight | 283.53600 |
| Flash Point | 158ºC |
| Exact Mass | 281.96200 |
| PSA | 35.53000 |
| LogP | 3.15420 |
| Vapour Pressure | 5.85E-06mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | GMYRFASSFLNTPN-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)OCCCl |
|
~%
Acetic acid,2-(... CAS#:19810-30-1 |
| Literature: Newman; Fones; Renoll Journal of the American Chemical Society, 1947 , vol. 69, p. 718,721 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| <2,4-Dichlor-phenoxy>-essigsaeure-2-chlor-aethylester |
| 2,4-Dichlorophenoxyacetic acid b-chloroethyl ester |