4'-(1,1-dimethylethyl)[1,1'-biphenyl]-4-ol structure
|
Common Name | 4'-(1,1-dimethylethyl)[1,1'-biphenyl]-4-ol | ||
|---|---|---|---|---|
| CAS Number | 19812-92-1 | Molecular Weight | 226.31400 | |
| Density | 1.029g/cm3 | Boiling Point | 338.2ºC at 760 mmHg | |
| Molecular Formula | C16H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.1ºC | |
| Name | 4-(4-tert-butylphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.029g/cm3 |
|---|---|
| Boiling Point | 338.2ºC at 760 mmHg |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.31400 |
| Flash Point | 159.1ºC |
| Exact Mass | 226.13600 |
| PSA | 20.23000 |
| LogP | 4.35670 |
| Vapour Pressure | 5.08E-05mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | NXIXRLZJEZGKGY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(-c2ccc(O)cc2)cc1 |
|
~93%
4'-(1,1-dimethy... CAS#:19812-92-1 |
| Literature: E.I. DUPONT DE NEMOURS AND COMPANY Patent: WO2006/72015 A2, 2006 ; Location in patent: Page/Page column 20 ; |
|
~74%
4'-(1,1-dimethy... CAS#:19812-92-1 |
| Literature: Revell, Jefferson D.; Ganesan Organic Letters, 2002 , vol. 4, # 18 p. 3071 - 3073 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (1,1'-Biphenyl)-4-ol,4'-(1,1-dimethylethyl) |
| EINECS 243-342-8 |
| 4'-tert-butylbiphenyl-4-ol |
| 4'-Tert-butyl[1,1'-biphenyl]-4-ol |
| 4-(4-t-butylphenyl)-phenol |