tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate
![tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate Structure](https://image.chemsrc.com/caspic/060/1982-90-7.png)
tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate structure
|
Common Name | tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1982-90-7 | Molecular Weight | 480.32700 | |
| Density | N/A | Boiling Point | 558.9ºC at 760 mmHg | |
| Molecular Formula | C20H19NO8Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 558.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H19NO8Se |
| Molecular Weight | 480.32700 |
| Flash Point | 291.8ºC |
| Exact Mass | 481.02800 |
| PSA | 110.13000 |
| Vapour Pressure | 1.59E-12mmHg at 25°C |
| InChIKey | LCLCEKKSQFMDBX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)C(C(=O)OC)N2C(=C1)[Se]c1ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
tetramethyl 9,1... CAS#:1982-90-7 |
| Literature: Acheson,R.M. et al. Journal of the Chemical Society, 1965 , p. 3200 - 3206 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-Dihydro-azepino<2.1-b>benzoselenazol-7,8,9,10-tetracarbonsaeure-tetramethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate have? |
| A: English synonyms of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate: 9,10-Dihydro-azepinobenzoselenazol-7,8,9,10-tetracarbonsaeure-tetramethylester. |
| Q: What is the boiling point of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate? |
| A: Boiling point of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate is 558.9ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate? |
| A: Polar surface area (PSA) of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate is 110.13000. |
| Q: What is the SMILES notation of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate? |
| A: SMILES notation of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate is COC(=O)C1=C(C(=O)OC)C(C(=O)OC)C(C(=O)OC)N2C(=C1)[Se]c1ccccc12. |
| Q: What are the upstream materials of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate? |
| A: Related upstream materials(CAS) of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate: 2818-88-4;762-42-5. |
| Q: What is the English name of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate? |
| A: The English name of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate is tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate. |
| Q: What is the molecular weight of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate? |
| A: Molecular weight of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate is 480.32700. |
| Q: What is the Chinese name of 1982-90-7? |
| A: Chinese name of 1982-90-7 is 1982-90-7. |
| Q: What is the CAS number of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate? |
| A: CAS number of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate is 1982-90-7. |
| Q: What is the InChIKey of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate? |
| A: InChIKey of tetramethyl 9,10-dihydroazepino[2,1-b][1,3]benzoselenazole-7,8,9,10-tetracarboxylate is LCLCEKKSQFMDBX-UHFFFAOYSA-N. |