3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid
Modify Date: 2025-09-30 06:17:44
![3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid Structure](https://www.chemsrc.com/extcaspic/172/1982241-75-7.png)
3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid structure
|
Common Name | 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1982241-75-7 | Molecular Weight | 355.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12Cl2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H12Cl2O5 |
|---|---|
| Molecular Weight | 355.2 |
| InChIKey | CFJBHVNBEZBSFK-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C(=O)O)cc(Cl)c1OC(=O)c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1982241-75-7? |
| A: Chinese name of 1982241-75-7 is 1982241-75-7. |
| Q: What is the CAS number of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid? |
| A: CAS number of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid is 1982241-75-7. |
| Q: What is the English name of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid? |
| A: The English name of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid is 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid. |
| Q: What is the InChIKey of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid? |
| A: InChIKey of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid is CFJBHVNBEZBSFK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid? |
| A: Molecular formula of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid is C16H12Cl2O5. |
| Q: What is the SMILES notation of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid? |
| A: SMILES notation of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid is CCOc1cc(C(=O)O)cc(Cl)c1OC(=O)c1ccc(Cl)cc1. |
| Q: What is the molecular weight of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid? |
| A: Molecular weight of 3-Chloro-4-{[(4-chlorophenyl)carbonyl]oxy}-5-ethoxybenzoic acid is 355.2. |