Benzyl 2-hydroxyphenylacetate
Modify Date: 2025-11-04 09:10:29
Benzyl 2-hydroxyphenylacetate structure
|
Common Name | Benzyl 2-hydroxyphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 19829-38-0 | Molecular Weight | 242.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 2-hydroxyphenylacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.27 |
| InChIKey | HQKFEUBRVQNYME-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 19829-38-0? |
| A: Chinese name of 19829-38-0 is 19829-38-0. |
| Q: What is the molecular weight of Benzyl 2-hydroxyphenylacetate? |
| A: Molecular weight of Benzyl 2-hydroxyphenylacetate is 242.27. |
| Q: What is the InChIKey of Benzyl 2-hydroxyphenylacetate? |
| A: InChIKey of Benzyl 2-hydroxyphenylacetate is HQKFEUBRVQNYME-UHFFFAOYSA-N. |
| Q: What is the English name of Benzyl 2-hydroxyphenylacetate? |
| A: The English name of Benzyl 2-hydroxyphenylacetate is Benzyl 2-hydroxyphenylacetate. |
| Q: What is the SMILES notation of Benzyl 2-hydroxyphenylacetate? |
| A: SMILES notation of Benzyl 2-hydroxyphenylacetate is O=C(Cc1ccccc1O)OCc1ccccc1. |
| Q: What is the molecular formula of Benzyl 2-hydroxyphenylacetate? |
| A: Molecular formula of Benzyl 2-hydroxyphenylacetate is C15H14O3. |
| Q: What is the CAS number of Benzyl 2-hydroxyphenylacetate? |
| A: CAS number of Benzyl 2-hydroxyphenylacetate is 19829-38-0. |