Bis(4-chlorobenzyl) oxalate
Modify Date: 2025-08-24 20:08:40
Bis(4-chlorobenzyl) oxalate structure
|
Common Name | Bis(4-chlorobenzyl) oxalate | ||
|---|---|---|---|---|
| CAS Number | 19829-42-6 | Molecular Weight | 339.17000 | |
| Density | 1.374g/cm3 | Boiling Point | 440.786ºC at 760 mmHg | |
| Molecular Formula | C16H12Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.143ºC | |
| Name | bis[(4-chlorophenyl)methyl] oxalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 440.786ºC at 760 mmHg |
| Molecular Formula | C16H12Cl2O4 |
| Molecular Weight | 339.17000 |
| Flash Point | 169.143ºC |
| Exact Mass | 338.01100 |
| PSA | 52.60000 |
| LogP | 3.78000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | QWHCTYYBLDCYIT-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccc(Cl)cc1)C(=O)OCc1ccc(Cl)cc1 |
| HS Code | 2917119000 |
|---|
|
~%
Bis(4-chloroben... CAS#:19829-42-6 |
| Literature: Trahanovsky,W.S. et al. Journal of the American Chemical Society, 1968 , vol. 90, p. 2839 - 2842 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:5216-35-3| HS Code | 2917119000 |
|---|---|
| Summary | 2917119000 oxalic acid salts and esters VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Bis(4-chlorobenzyl) oxalate |