Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate
Modify Date: 2025-09-02 09:32:48
Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate structure
|
Common Name | Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1982931-88-3 | Molecular Weight | 233.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H11NO4 |
|---|---|
| Molecular Weight | 233.22 |
| InChIKey | VZIFEOGNDKQNKE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2cc(OC)ccc2[nH]c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate? |
| A: The English name of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate is Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate. |
| Q: What is the InChIKey of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate? |
| A: InChIKey of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate is VZIFEOGNDKQNKE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate? |
| A: Molecular weight of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate is 233.22. |
| Q: What is the Chinese name of 1982931-88-3? |
| A: Chinese name of 1982931-88-3 is 1982931-88-3. |
| Q: What is the CAS number of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate? |
| A: CAS number of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate is 1982931-88-3. |
| Q: What is the SMILES notation of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate? |
| A: SMILES notation of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate is COC(=O)c1cc2cc(OC)ccc2[nH]c1=O. |
| Q: What is the molecular formula of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate? |
| A: Molecular formula of Methyl6-methoxy-2-oxo-1,2-dihydroquinoline-3-carboxylate is C12H11NO4. |