2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol
Modify Date: 2026-08-30 18:50:00
![2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol Structure](https://www.chemsrc.com/extcaspic/047/1982933-36-7.png)
2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol structure
|
Common Name | 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1982933-36-7 | Molecular Weight | 255.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11ClFN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11ClFN3O |
|---|---|
| Molecular Weight | 255.67 |
| InChIKey | ZGVBRRGOZSUKPI-UHFFFAOYSA-N |
| SMILES | CC(C)(O)c1cn(-c2cc(F)cc(Cl)c2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol? |
| A: InChIKey of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol is ZGVBRRGOZSUKPI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol? |
| A: Molecular formula of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol is C11H11ClFN3O. |
| Q: What is the CAS number of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol? |
| A: CAS number of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol is 1982933-36-7. |
| Q: What is the English name of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol? |
| A: The English name of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol is 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol. |
| Q: What is the Chinese name of 1982933-36-7? |
| A: Chinese name of 1982933-36-7 is 1982933-36-7. |
| Q: What is the SMILES notation of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol? |
| A: SMILES notation of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol is CC(C)(O)c1cn(-c2cc(F)cc(Cl)c2)nn1. |
| Q: What is the molecular weight of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol? |
| A: Molecular weight of 2-[1-(3-chloro-5-fluorophenyl)-1H-1,2,3-triazol-4-yl]propan-2-ol is 255.67. |