Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] structure
|
Common Name | Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] | ||
|---|---|---|---|---|
| CAS Number | 1982950-41-3 | Molecular Weight | 466.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H20ClN3O3S |
|---|---|
| Molecular Weight | 466.0 |
| InChIKey | NOUQTKUOAOYAGU-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)C(Sc2nnc(-c3ccccc3C)o2)c2ccccc2)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio]? |
| A: The English name of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] is Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio]. |
| Q: What is the molecular weight of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio]? |
| A: Molecular weight of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] is 466.0. |
| Q: What is the InChIKey of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio]? |
| A: InChIKey of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] is NOUQTKUOAOYAGU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio]? |
| A: SMILES notation of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] is COc1ccc(NC(=O)C(Sc2nnc(-c3ccccc3C)o2)c2ccccc2)cc1Cl. |
| Q: What is the CAS number of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio]? |
| A: CAS number of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] is 1982950-41-3. |
| Q: What is the Chinese name of 1982950-41-3? |
| A: Chinese name of 1982950-41-3 is 1982950-41-3. |
| Q: What is the molecular formula of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio]? |
| A: Molecular formula of Benzeneacetamide, N-(3-chloro-4-methoxyphenyl)-I+/--[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]thio] is C24H20ClN3O3S. |