Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl
Modify Date: 2026-08-25 00:35:31
Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl structure
|
Common Name | Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl | ||
|---|---|---|---|---|
| CAS Number | 1982950-74-2 | Molecular Weight | 326.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20BrNO2 |
|---|---|
| Molecular Weight | 326.23 |
| InChIKey | AGYUXJOYFXHJPU-UHFFFAOYSA-N |
| SMILES | CN(C(=O)COc1cccc(Br)c1)C1CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl? |
| A: SMILES notation of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl is CN(C(=O)COc1cccc(Br)c1)C1CCCCC1. |
| Q: What is the Chinese name of 1982950-74-2? |
| A: Chinese name of 1982950-74-2 is 1982950-74-2. |
| Q: What is the molecular weight of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl? |
| A: Molecular weight of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl is 326.23. |
| Q: What is the InChIKey of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl? |
| A: InChIKey of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl is AGYUXJOYFXHJPU-UHFFFAOYSA-N. |
| Q: What is the English name of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl? |
| A: The English name of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl is Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl. |
| Q: What is the CAS number of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl? |
| A: CAS number of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl is 1982950-74-2. |
| Q: What is the molecular formula of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl? |
| A: Molecular formula of Acetamide, 2-(3-bromophenoxy)-N-cyclohexyl-N-methyl is C15H20BrNO2. |