3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine
Modify Date: 2026-08-20 16:40:27
![3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine Structure](https://www.chemsrc.com/extcaspic/369/1982999-77-8.png)
3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine structure
|
Common Name | 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine | ||
|---|---|---|---|---|
| CAS Number | 1982999-77-8 | Molecular Weight | 229.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16FN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16FN |
|---|---|
| Molecular Weight | 229.29 |
| InChIKey | MJWODAHROLEZOB-UHFFFAOYSA-N |
| SMILES | CCc1cccc(-c2cc(N)c(C)cc2F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine? |
| A: Molecular weight of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine is 229.29. |
| Q: What is the InChIKey of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine? |
| A: InChIKey of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine is MJWODAHROLEZOB-UHFFFAOYSA-N. |
| Q: What is the English name of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine? |
| A: The English name of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine is 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine. |
| Q: What is the Chinese name of 1982999-77-8? |
| A: Chinese name of 1982999-77-8 is 1982999-77-8. |
| Q: What is the CAS number of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine? |
| A: CAS number of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine is 1982999-77-8. |
| Q: What is the molecular formula of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine? |
| A: Molecular formula of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine is C15H16FN. |
| Q: What is the SMILES notation of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine? |
| A: SMILES notation of 3'-Ethyl-6-fluoro-4-methyl-[1,1'-biphenyl]-3-amine is CCc1cccc(-c2cc(N)c(C)cc2F)c1. |