1,16-diphenylhexadecane-3,5,12,14-tetrone structure
|
Common Name | 1,16-diphenylhexadecane-3,5,12,14-tetrone | ||
|---|---|---|---|---|
| CAS Number | 1983-92-2 | Molecular Weight | 434.56700 | |
| Density | 1.079g/cm3 | Boiling Point | 604.8ºC at 760 mmHg | |
| Molecular Formula | C28H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270ºC | |
| Name | 1,16-diphenylhexadecane-3,5,12,14-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.079g/cm3 |
|---|---|
| Boiling Point | 604.8ºC at 760 mmHg |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.56700 |
| Flash Point | 270ºC |
| Exact Mass | 434.24600 |
| PSA | 68.28000 |
| LogP | 5.64920 |
| Vapour Pressure | 1.41E-14mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | OADODDOMEYIGEB-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCC(=O)CC(=O)CCc1ccccc1)CC(=O)CCc1ccccc1 |
|
~%
1,16-diphenylhe... CAS#:1983-92-2 |
| Literature: Hampton,K.G. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 1413 - 1416 |
|
~%
1,16-diphenylhe... CAS#:1983-92-2 |
| Literature: Hampton,K.G.; Hauser,C.R. Journal of Organic Chemistry, 1965 , vol. 30, p. 2934 - 2937 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,16-Diphenyl-3,5,12,14-hexadecantetron |